C13H24O4 — CID 59071283
(2R,3S)-2-[(4R,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylhex-5-en-3-ol (PubChem CID 59071283) has the molecular formula C13H24O4 and a molecular weight of 244.33 g/mol. Its IUPAC name is (2R,3S)-2-[(4R,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylhex-5-en-3-ol.
| Compound Name | (2R,3S)-2-[(4R,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylhex-5-en-3-ol |
|---|---|
| PubChem CID | 59071283 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | (2R,3S)-2-[(4R,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylhex-5-en-3-ol |
| SMILES | C=CC[C@](C)(O)[C@H](C)[C@H]1OC(C)(C)O[C@H]1CO |
| InChI | InChI=1S/C13H24O4/c1-6-7-13(5,15)9(2)11-10(8-14)16-12(3,4)17-11/h6,9-11,14-15H,1,7-8H2,2-5H3/t9-,10+,11-,13+/m1/s1 |
| InChIKey | FAJWOZXMPVEYFM-XZUYRWCXSA-N |
| XLogP | 1.46 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|