C18H36O4Si — CID 59071296
(3S,4R)-4-[(4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylpent-1-en-3-ol (PubChem CID 59071296) has the molecular formula C18H36O4Si and a molecular weight of 344.57 g/mol. Its IUPAC name is (3S,4R)-4-[(4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylpent-1-en-3-ol.
| Compound Name | (3S,4R)-4-[(4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylpent-1-en-3-ol |
|---|---|
| PubChem CID | 59071296 |
| Molecular Formula | C18H36O4Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (3S,4R)-4-[(4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylpent-1-en-3-ol |
| SMILES | C=C[C@](C)(O)[C@H](C)[C@H]1OC(C)(C)O[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36O4Si/c1-11-18(8,19)13(2)15-14(21-17(6,7)22-15)12-20-23(9,10)16(3,4)5/h11,13-15,19H,1,12H2,2-10H3/t13-,14+,15-,18+/m1/s1 |
| InChIKey | JYDCTNTZVJWTFP-FSZRXZPDSA-N |
| XLogP | 4.10 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|