C13H15ClN2 — CID 59071341
(5R)-10-chloro-5-methyl-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole (PubChem CID 59071341) has the molecular formula C13H15ClN2 and a molecular weight of 234.73 g/mol. Its IUPAC name is (5R)-10-chloro-5-methyl-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole.
| Compound Name | (5R)-10-chloro-5-methyl-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole |
|---|---|
| PubChem CID | 59071341 |
| Molecular Formula | C13H15ClN2 |
| Molecular Weight | 234.73 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | (5R)-10-chloro-5-methyl-1,2,3,4,5,6-hexahydroazepino[4,5-b]indole |
| SMILES | C[C@@H]1CNCCc2c1[nH]c1cccc(Cl)c21 |
| InChI | InChI=1S/C13H15ClN2/c1-8-7-15-6-5-9-12-10(14)3-2-4-11(12)16-13(8)9/h2-4,8,15-16H,5-7H2,1H3/t8-/m1/s1 |
| InChIKey | KQRVTLGTYSNEQE-MRVPVSSYSA-N |
| XLogP | 3.07 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.73 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |