C23H38F2O6 — CID 59071374
methyl (Z)-7-[(2R,3R,5S)-2-[2-[2-(1,1-difluoropentyl)-1,3-dioxolan-2-yl]ethyl]-3,5-dihydroxycyclopentyl]hept-5-enoate (PubChem CID 59071374) has the molecular formula C23H38F2O6 and a molecular weight of 448.55 g/mol. Its IUPAC name is methyl (Z)-7-[(2R,3R,5S)-2-[2-[2-(1,1-difluoropentyl)-1,3-dioxolan-2-yl]ethyl]-3,5-dihydroxycyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(2R,3R,5S)-2-[2-[2-(1,1-difluoropentyl)-1,3-dioxolan-2-yl]ethyl]-3,5-dihydroxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 59071374 |
| Molecular Formula | C23H38F2O6 |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | methyl (Z)-7-[(2R,3R,5S)-2-[2-[2-(1,1-difluoropentyl)-1,3-dioxolan-2-yl]ethyl]-3,5-dihydroxycyclopentyl]hept-5-enoate |
| SMILES | CCCCC(F)(F)C1(CC[C@@H]2C(C/C=C\CCCC(=O)OC)[C@@H](O)C[C@H]2O)OCCO1 |
| InChI | InChI=1S/C23H38F2O6/c1-3-4-12-22(24,25)23(30-14-15-31-23)13-11-18-17(19(26)16-20(18)27)9-7-5-6-8-10-21(28)29-2/h5,7,17-20,26-27H,3-4,6,8-16H2,1-2H3/b7-5-/t17?,18-,19+,20-/m1/s1 |
| InChIKey | HKEMBRSDAPDDTP-GRJLLZPBSA-N |
| XLogP | 3.98 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|