About [(6S,7S)-7-(aminomethyl)-1,4-diazocan-6-yl]methanamine
[(6S,7S)-7-(aminomethyl)-1,4-diazocan-6-yl]methanamine (PubChem CID 59071533) has the molecular formula C8H20N4
and a molecular weight of 172.28 g/mol. Its IUPAC name is [(6S,7S)-7-(aminomethyl)-1,4-diazocan-6-yl]methanamine.
Molecular Properties
| Compound Name | [(6S,7S)-7-(aminomethyl)-1,4-diazocan-6-yl]methanamine |
| PubChem CID | 59071533 |
| Molecular Formula | C8H20N4 |
| Molecular Weight | 172.28 g/mol |
| Exact Mass | 172.17 |
| IUPAC Name | [(6S,7S)-7-(aminomethyl)-1,4-diazocan-6-yl]methanamine |
| SMILES | NC[C@H]1CNCCNC[C@@H]1CN |
| InChI | InChI=1S/C8H20N4/c9-3-7-5-11-1-2-12-6-8(7)4-10/h7-8,11-12H,1-6,9-10H2/t7-,8-/m0/s1 |
| InChIKey | KFDSAXVFUOUJOW-YUMQZZPRSA-N |
| XLogP | -1.67 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.28 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(6S,7S)-7-(aminomethyl)-1,4-diazocan-6-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(6S,7S)-7-(aminomethyl)-1,4-diazocan-6-yl]methanamine?
The IUPAC name of [(6S,7S)-7-(aminomethyl)-1,4-diazocan-6-yl]methanamine (CID 59071533) is [(6S,7S)-7-(aminomethyl)-1,4-diazocan-6-yl]methanamine.
What is the SMILES notation for [(6S,7S)-7-(aminomethyl)-1,4-diazocan-6-yl]methanamine?
The canonical SMILES for [(6S,7S)-7-(aminomethyl)-1,4-diazocan-6-yl]methanamine is NC[C@H]1CNCCNC[C@@H]1CN.
What is the InChIKey of [(6S,7S)-7-(aminomethyl)-1,4-diazocan-6-yl]methanamine?
The InChIKey is KFDSAXVFUOUJOW-YUMQZZPRSA-N. The full InChI is InChI=1S/C8H20N4/c9-3-7-5-11-1-2-12-6-8(7)4-10/h7-8,11-12H,1-6,9-10H2/t7-,8-/m0/s1.
What are the key properties of [(6S,7S)-7-(aminomethyl)-1,4-diazocan-6-yl]methanamine?
[(6S,7S)-7-(aminomethyl)-1,4-diazocan-6-yl]methanamine has a molecular weight of 172.28 g/mol, XLogP of -1.67, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(6S,7S)-7-(aminomethyl)-1,4-diazocan-6-yl]methanamine is sourced from PubChem (CID 59071533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).