About (6R,7S)-7-(aminomethyl)-1,4-diazocan-6-amine
(6R,7S)-7-(aminomethyl)-1,4-diazocan-6-amine (PubChem CID 59071535) has the molecular formula C7H18N4
and a molecular weight of 158.25 g/mol. Its IUPAC name is (6R,7S)-7-(aminomethyl)-1,4-diazocan-6-amine.
Molecular Properties
| Compound Name | (6R,7S)-7-(aminomethyl)-1,4-diazocan-6-amine |
| PubChem CID | 59071535 |
| Molecular Formula | C7H18N4 |
| Molecular Weight | 158.25 g/mol |
| Exact Mass | 158.15 |
| IUPAC Name | (6R,7S)-7-(aminomethyl)-1,4-diazocan-6-amine |
| SMILES | NC[C@H]1CNCCNC[C@@H]1N |
| InChI | InChI=1S/C7H18N4/c8-3-6-4-10-1-2-11-5-7(6)9/h6-7,10-11H,1-5,8-9H2/t6-,7-/m0/s1 |
| InChIKey | SHHDGVWIGAZXCY-BQBZGAKWSA-N |
| XLogP | -1.92 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.25 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6R,7S)-7-(aminomethyl)-1,4-diazocan-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R,7S)-7-(aminomethyl)-1,4-diazocan-6-amine?
The IUPAC name of (6R,7S)-7-(aminomethyl)-1,4-diazocan-6-amine (CID 59071535) is (6R,7S)-7-(aminomethyl)-1,4-diazocan-6-amine.
What is the SMILES notation for (6R,7S)-7-(aminomethyl)-1,4-diazocan-6-amine?
The canonical SMILES for (6R,7S)-7-(aminomethyl)-1,4-diazocan-6-amine is NC[C@H]1CNCCNC[C@@H]1N.
What is the InChIKey of (6R,7S)-7-(aminomethyl)-1,4-diazocan-6-amine?
The InChIKey is SHHDGVWIGAZXCY-BQBZGAKWSA-N. The full InChI is InChI=1S/C7H18N4/c8-3-6-4-10-1-2-11-5-7(6)9/h6-7,10-11H,1-5,8-9H2/t6-,7-/m0/s1.
What are the key properties of (6R,7S)-7-(aminomethyl)-1,4-diazocan-6-amine?
(6R,7S)-7-(aminomethyl)-1,4-diazocan-6-amine has a molecular weight of 158.25 g/mol, XLogP of -1.92, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6R,7S)-7-(aminomethyl)-1,4-diazocan-6-amine is sourced from PubChem (CID 59071535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).