About (6R,7S)-N-ethyl-7-(ethylaminomethyl)-1,4-diazocan-6-amine
(6R,7S)-N-ethyl-7-(ethylaminomethyl)-1,4-diazocan-6-amine (PubChem CID 59071554) has the molecular formula C11H26N4
and a molecular weight of 214.36 g/mol. Its IUPAC name is (6R,7S)-N-ethyl-7-(ethylaminomethyl)-1,4-diazocan-6-amine.
Molecular Properties
| Compound Name | (6R,7S)-N-ethyl-7-(ethylaminomethyl)-1,4-diazocan-6-amine |
| PubChem CID | 59071554 |
| Molecular Formula | C11H26N4 |
| Molecular Weight | 214.36 g/mol |
| Exact Mass | 214.22 |
| IUPAC Name | (6R,7S)-N-ethyl-7-(ethylaminomethyl)-1,4-diazocan-6-amine |
| SMILES | CCNC[C@H]1CNCCNC[C@@H]1NCC |
| InChI | InChI=1S/C11H26N4/c1-3-12-7-10-8-13-5-6-14-9-11(10)15-4-2/h10-15H,3-9H2,1-2H3/t10-,11-/m0/s1 |
| InChIKey | DGTGWOXJWITEJK-QWRGUYRKSA-N |
| XLogP | -0.62 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.36 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6R,7S)-N-ethyl-7-(ethylaminomethyl)-1,4-diazocan-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R,7S)-N-ethyl-7-(ethylaminomethyl)-1,4-diazocan-6-amine?
The IUPAC name of (6R,7S)-N-ethyl-7-(ethylaminomethyl)-1,4-diazocan-6-amine (CID 59071554) is (6R,7S)-N-ethyl-7-(ethylaminomethyl)-1,4-diazocan-6-amine.
What is the SMILES notation for (6R,7S)-N-ethyl-7-(ethylaminomethyl)-1,4-diazocan-6-amine?
The canonical SMILES for (6R,7S)-N-ethyl-7-(ethylaminomethyl)-1,4-diazocan-6-amine is CCNC[C@H]1CNCCNC[C@@H]1NCC.
What is the InChIKey of (6R,7S)-N-ethyl-7-(ethylaminomethyl)-1,4-diazocan-6-amine?
The InChIKey is DGTGWOXJWITEJK-QWRGUYRKSA-N. The full InChI is InChI=1S/C11H26N4/c1-3-12-7-10-8-13-5-6-14-9-11(10)15-4-2/h10-15H,3-9H2,1-2H3/t10-,11-/m0/s1.
What are the key properties of (6R,7S)-N-ethyl-7-(ethylaminomethyl)-1,4-diazocan-6-amine?
(6R,7S)-N-ethyl-7-(ethylaminomethyl)-1,4-diazocan-6-amine has a molecular weight of 214.36 g/mol, XLogP of -0.62, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6R,7S)-N-ethyl-7-(ethylaminomethyl)-1,4-diazocan-6-amine is sourced from PubChem (CID 59071554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).