C13H14O4 — CID 59071612
(1S,4R,4aS,8aR)-1,4-dimethyl-5,8-dioxo-4,8a-dihydro-1H-naphthalene-4a-carboxylic acid (PubChem CID 59071612) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is (1S,4R,4aS,8aR)-1,4-dimethyl-5,8-dioxo-4,8a-dihydro-1H-naphthalene-4a-carboxylic acid.
| Compound Name | (1S,4R,4aS,8aR)-1,4-dimethyl-5,8-dioxo-4,8a-dihydro-1H-naphthalene-4a-carboxylic acid |
|---|---|
| PubChem CID | 59071612 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | (1S,4R,4aS,8aR)-1,4-dimethyl-5,8-dioxo-4,8a-dihydro-1H-naphthalene-4a-carboxylic acid |
| SMILES | C[C@@H]1C=C[C@H](C)[C@H]2C(=O)C=CC(=O)[C@]12C(=O)O |
| InChI | InChI=1S/C13H14O4/c1-7-3-4-8(2)13(12(16)17)10(15)6-5-9(14)11(7)13/h3-8,11H,1-2H3,(H,16,17)/t7-,8+,11-,13+/m0/s1 |
| InChIKey | PSWAXIYXVRLUCH-FGZNQLEESA-N |
| XLogP | 1.22 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|