C6H13NS — CID 59071954
(4R,5S)-3,4,5-trimethyl-1,3-thiazolidine (PubChem CID 59071954) has the molecular formula C6H13NS and a molecular weight of 131.24 g/mol. Its IUPAC name is (4R,5S)-3,4,5-trimethyl-1,3-thiazolidine.
| Compound Name | (4R,5S)-3,4,5-trimethyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 59071954 |
| Molecular Formula | C6H13NS |
| Molecular Weight | 131.24 g/mol |
| Exact Mass | 131.08 |
| IUPAC Name | (4R,5S)-3,4,5-trimethyl-1,3-thiazolidine |
| SMILES | C[C@@H]1SCN(C)[C@@H]1C |
| InChI | InChI=1S/C6H13NS/c1-5-6(2)8-4-7(5)3/h5-6H,4H2,1-3H3/t5-,6+/m1/s1 |
| InChIKey | RWSRMQQZGWAHMO-RITPCOANSA-N |
| XLogP | 1.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |