C12H21NO2 — CID 59072056
1,2,3,3a,6,7,8,8a-octahydrocyclohepta[b]pyrrol-3-yl(ethoxy)methanol (PubChem CID 59072056) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is 1,2,3,3a,6,7,8,8a-octahydrocyclohepta[b]pyrrol-3-yl(ethoxy)methanol.
| Compound Name | 1,2,3,3a,6,7,8,8a-octahydrocyclohepta[b]pyrrol-3-yl(ethoxy)methanol |
|---|---|
| PubChem CID | 59072056 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 1,2,3,3a,6,7,8,8a-octahydrocyclohepta[b]pyrrol-3-yl(ethoxy)methanol |
| SMILES | CCOC(O)C1CNC2CCCC=CC21 |
| InChI | InChI=1S/C12H21NO2/c1-2-15-12(14)10-8-13-11-7-5-3-4-6-9(10)11/h4,6,9-14H,2-3,5,7-8H2,1H3 |
| InChIKey | HGSZYOUMPIHJJT-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|