C18H11N3O4 — CID 59072167
(5Z)-5-(furan-2-ylmethylidene)-1-quinolin-8-yl-1,3-diazinane-2,4,6-trione (PubChem CID 59072167) has the molecular formula C18H11N3O4 and a molecular weight of 333.30 g/mol. Its IUPAC name is (5Z)-5-(furan-2-ylmethylidene)-1-quinolin-8-yl-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-5-(furan-2-ylmethylidene)-1-quinolin-8-yl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 59072167 |
| Molecular Formula | C18H11N3O4 |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | (5Z)-5-(furan-2-ylmethylidene)-1-quinolin-8-yl-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(c2cccc3cccnc23)C(=O)/C1=C\c1ccco1 |
| InChI | InChI=1S/C18H11N3O4/c22-16-13(10-12-6-3-9-25-12)17(23)21(18(24)20-16)14-7-1-4-11-5-2-8-19-15(11)14/h1-10H,(H,20,22,24)/b13-10- |
| InChIKey | MZEPETOJTKUUMK-RAXLEYEMSA-N |
| XLogP | 2.49 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|