About 8-tert-butyl-6-methyl-[1,3]thiazolo[4,5-f]quinolin-6-ium
8-tert-butyl-6-methyl-[1,3]thiazolo[4,5-f]quinolin-6-ium (PubChem CID 59072235) has the molecular formula C15H17N2S+
and a molecular weight of 257.38 g/mol. Its IUPAC name is 8-tert-butyl-6-methyl-[1,3]thiazolo[4,5-f]quinolin-6-ium.
Molecular Properties
| Compound Name | 8-tert-butyl-6-methyl-[1,3]thiazolo[4,5-f]quinolin-6-ium |
| PubChem CID | 59072235 |
| Molecular Formula | C15H17N2S+ |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 8-tert-butyl-6-methyl-[1,3]thiazolo[4,5-f]quinolin-6-ium |
| SMILES | C[n+]1cc(C(C)(C)C)cc2c3ncsc3ccc21 |
| InChI | InChI=1S/C15H17N2S/c1-15(2,3)10-7-11-12(17(4)8-10)5-6-13-14(11)16-9-18-13/h5-9H,1-4H3/q+1 |
| InChIKey | KDVVOHAZSUYIMV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 8-tert-butyl-6-methyl-[1,3]thiazolo[4,5-f]quinolin-6-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-tert-butyl-6-methyl-[1,3]thiazolo[4,5-f]quinolin-6-ium?
The IUPAC name of 8-tert-butyl-6-methyl-[1,3]thiazolo[4,5-f]quinolin-6-ium (CID 59072235) is 8-tert-butyl-6-methyl-[1,3]thiazolo[4,5-f]quinolin-6-ium.
What is the SMILES notation for 8-tert-butyl-6-methyl-[1,3]thiazolo[4,5-f]quinolin-6-ium?
The canonical SMILES for 8-tert-butyl-6-methyl-[1,3]thiazolo[4,5-f]quinolin-6-ium is C[n+]1cc(C(C)(C)C)cc2c3ncsc3ccc21.
What is the InChIKey of 8-tert-butyl-6-methyl-[1,3]thiazolo[4,5-f]quinolin-6-ium?
The InChIKey is KDVVOHAZSUYIMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N2S/c1-15(2,3)10-7-11-12(17(4)8-10)5-6-13-14(11)16-9-18-13/h5-9H,1-4H3/q+1.
What are the key properties of 8-tert-butyl-6-methyl-[1,3]thiazolo[4,5-f]quinolin-6-ium?
8-tert-butyl-6-methyl-[1,3]thiazolo[4,5-f]quinolin-6-ium has a molecular weight of 257.38 g/mol, XLogP of 3.57, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-tert-butyl-6-methyl-[1,3]thiazolo[4,5-f]quinolin-6-ium is sourced from PubChem (CID 59072235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).