About 5-but-3-enyl-2H-indole
5-but-3-enyl-2H-indole (PubChem CID 59072277) has the molecular formula C12H13N
and a molecular weight of 171.24 g/mol. Its IUPAC name is 5-but-3-enyl-2H-indole.
Molecular Properties
| Compound Name | 5-but-3-enyl-2H-indole |
| PubChem CID | 59072277 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 5-but-3-enyl-2H-indole |
| SMILES | C=CCCc1ccc2c(c1)=CCN=2 |
| InChI | InChI=1S/C12H13N/c1-2-3-4-10-5-6-12-11(9-10)7-8-13-12/h2,5-7,9H,1,3-4,8H2 |
| InChIKey | YOTYFPBVMIIVQA-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-but-3-enyl-2H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-but-3-enyl-2H-indole?
The IUPAC name of 5-but-3-enyl-2H-indole (CID 59072277) is 5-but-3-enyl-2H-indole.
What is the SMILES notation for 5-but-3-enyl-2H-indole?
The canonical SMILES for 5-but-3-enyl-2H-indole is C=CCCc1ccc2c(c1)=CCN=2.
What is the InChIKey of 5-but-3-enyl-2H-indole?
The InChIKey is YOTYFPBVMIIVQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N/c1-2-3-4-10-5-6-12-11(9-10)7-8-13-12/h2,5-7,9H,1,3-4,8H2.
What are the key properties of 5-but-3-enyl-2H-indole?
5-but-3-enyl-2H-indole has a molecular weight of 171.24 g/mol, XLogP of 1.22, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-but-3-enyl-2H-indole is sourced from PubChem (CID 59072277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).