C11H20N2O2 — CID 59072766
methyl (E,2S)-7-(1-aminoethylideneamino)-2-methylhept-5-enoate (PubChem CID 59072766) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is methyl (E,2S)-7-(1-aminoethylideneamino)-2-methylhept-5-enoate.
| Compound Name | methyl (E,2S)-7-(1-aminoethylideneamino)-2-methylhept-5-enoate |
|---|---|
| PubChem CID | 59072766 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | methyl (E,2S)-7-(1-aminoethylideneamino)-2-methylhept-5-enoate |
| SMILES | COC(=O)[C@@H](C)CC/C=C/C/N=C(\C)N |
| InChI | InChI=1S/C11H20N2O2/c1-9(11(14)15-3)7-5-4-6-8-13-10(2)12/h4,6,9H,5,7-8H2,1-3H3,(H2,12,13)/b6-4+/t9-/m0/s1 |
| InChIKey | HPTBYDCTYJEJBL-DNQSNQRASA-N |
| XLogP | 1.51 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|