About N'-[(Z,6R)-6-amino-2-methylhept-2-enyl]ethanimidamide
N'-[(Z,6R)-6-amino-2-methylhept-2-enyl]ethanimidamide (PubChem CID 59072782) has the molecular formula C10H21N3
and a molecular weight of 183.30 g/mol. Its IUPAC name is N'-[(Z,6R)-6-amino-2-methylhept-2-enyl]ethanimidamide.
Molecular Properties
| Compound Name | N'-[(Z,6R)-6-amino-2-methylhept-2-enyl]ethanimidamide |
| PubChem CID | 59072782 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | N'-[(Z,6R)-6-amino-2-methylhept-2-enyl]ethanimidamide |
| SMILES | C/C(=C/CC[C@@H](C)N)C/N=C(\C)N |
| InChI | InChI=1S/C10H21N3/c1-8(7-13-10(3)12)5-4-6-9(2)11/h5,9H,4,6-7,11H2,1-3H3,(H2,12,13)/b8-5-/t9-/m1/s1 |
| InChIKey | OZFUZOJXMALCLP-BZJXQOFCSA-N |
| XLogP | 1.44 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N'-[(Z,6R)-6-amino-2-methylhept-2-enyl]ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(Z,6R)-6-amino-2-methylhept-2-enyl]ethanimidamide?
The IUPAC name of N'-[(Z,6R)-6-amino-2-methylhept-2-enyl]ethanimidamide (CID 59072782) is N'-[(Z,6R)-6-amino-2-methylhept-2-enyl]ethanimidamide.
What is the SMILES notation for N'-[(Z,6R)-6-amino-2-methylhept-2-enyl]ethanimidamide?
The canonical SMILES for N'-[(Z,6R)-6-amino-2-methylhept-2-enyl]ethanimidamide is C/C(=C/CC[C@@H](C)N)C/N=C(\C)N.
What is the InChIKey of N'-[(Z,6R)-6-amino-2-methylhept-2-enyl]ethanimidamide?
The InChIKey is OZFUZOJXMALCLP-BZJXQOFCSA-N. The full InChI is InChI=1S/C10H21N3/c1-8(7-13-10(3)12)5-4-6-9(2)11/h5,9H,4,6-7,11H2,1-3H3,(H2,12,13)/b8-5-/t9-/m1/s1.
What are the key properties of N'-[(Z,6R)-6-amino-2-methylhept-2-enyl]ethanimidamide?
N'-[(Z,6R)-6-amino-2-methylhept-2-enyl]ethanimidamide has a molecular weight of 183.30 g/mol, XLogP of 1.44, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(Z,6R)-6-amino-2-methylhept-2-enyl]ethanimidamide is sourced from PubChem (CID 59072782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).