About 3-(2-tritioethynyl)phenol;tris(yttrium)
3-(2-tritioethynyl)phenol;tris(yttrium) (PubChem CID 59072997) has the molecular formula C8H6OY3
and a molecular weight of 386.86 g/mol. Its IUPAC name is 3-(2-tritioethynyl)phenol;tris(yttrium).
Molecular Properties
| Compound Name | 3-(2-tritioethynyl)phenol;tris(yttrium) |
| PubChem CID | 59072997 |
| Molecular Formula | C8H6OY3 |
| Molecular Weight | 386.86 g/mol |
| Exact Mass | 386.77 |
| IUPAC Name | 3-(2-tritioethynyl)phenol;tris(yttrium) |
| SMILES | [3H]C#Cc1cccc(O)c1.[Y].[Y].[Y] |
| InChI | InChI=1S/C8H6O.3Y/c1-2-7-4-3-5-8(9)6-7;;;/h1,3-6,9H;;;/i1T;;; |
| InChIKey | ZZDMJMSSCCCPEB-CWPDLPROSA-N |
| XLogP | 1.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.86 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-tritioethynyl)phenol;tris(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-tritioethynyl)phenol;tris(yttrium)?
The IUPAC name of 3-(2-tritioethynyl)phenol;tris(yttrium) (CID 59072997) is 3-(2-tritioethynyl)phenol;tris(yttrium).
What is the SMILES notation for 3-(2-tritioethynyl)phenol;tris(yttrium)?
The canonical SMILES for 3-(2-tritioethynyl)phenol;tris(yttrium) is [3H]C#Cc1cccc(O)c1.[Y].[Y].[Y].
What is the InChIKey of 3-(2-tritioethynyl)phenol;tris(yttrium)?
The InChIKey is ZZDMJMSSCCCPEB-CWPDLPROSA-N. The full InChI is InChI=1S/C8H6O.3Y/c1-2-7-4-3-5-8(9)6-7;;;/h1,3-6,9H;;;/i1T;;;.
What are the key properties of 3-(2-tritioethynyl)phenol;tris(yttrium)?
3-(2-tritioethynyl)phenol;tris(yttrium) has a molecular weight of 386.86 g/mol, XLogP of 1.37, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-tritioethynyl)phenol;tris(yttrium) is sourced from PubChem (CID 59072997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).