C53H47IMgN4+2 — CID 59073172
magnesium 5-(4-iodophenyl)-10,15,20-tris(2,4,6-trimethylphenyl)porphyrin-22,24-diium-21,23-diide (PubChem CID 59073172) has the molecular formula C53H47IMgN4+2 and a molecular weight of 891.20 g/mol. Its IUPAC name is magnesium 5-(4-iodophenyl)-10,15,20-tris(2,4,6-trimethylphenyl)porphyrin-22,24-diium-21,23-diide.
| Compound Name | magnesium 5-(4-iodophenyl)-10,15,20-tris(2,4,6-trimethylphenyl)porphyrin-22,24-diium-21,23-diide |
|---|---|
| PubChem CID | 59073172 |
| Molecular Formula | C53H47IMgN4+2 |
| Molecular Weight | 891.20 g/mol |
| Exact Mass | 890.27 |
| IUPAC Name | magnesium 5-(4-iodophenyl)-10,15,20-tris(2,4,6-trimethylphenyl)porphyrin-22,24-diium-21,23-diide |
| SMILES | Cc1cc(C)c(-c2c3[nH+]c(c(-c4ccc(I)cc4)c4ccc([n-]4)c(-c4c(C)cc(C)cc4C)c4[nH+]c(c(-c5c(C)cc(C)cc5C)c5ccc2[n-]5)C=C4)C=C3)c(C)c1.[Mg+2] |
| InChI | InChI=1S/C53H45IN4.Mg/c1-28-22-31(4)47(32(5)23-28)51-41-16-14-39(55-41)50(37-10-12-38(54)13-11-37)40-15-17-42(56-40)52(48-33(6)24-29(2)25-34(48)7)44-19-21-46(58-44)53(45-20-18-43(51)57-45)49-35(8)26-30(3)27-36(49)9;/h10-27H,1-9H3;/q-2;+2/p+2/b50-39-,50-40-,51-41+,51-43+,52-42+,52-44+,53-45+,53-46+; |
| InChIKey | OVZDLBCFYVFPHT-ICRMOVKOSA-P |
| XLogP | 12.42 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.20 |
| LogP ≤ 5 | 12.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|