C25H34O — CID 59073453
(2R,3S,4S,5R,6R)-2-ethyl-3,4,5-trimethyl-6-[4-methyl-3-[(4-methylphenyl)methyl]phenyl]oxane (PubChem CID 59073453) has the molecular formula C25H34O and a molecular weight of 350.55 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-ethyl-3,4,5-trimethyl-6-[4-methyl-3-[(4-methylphenyl)methyl]phenyl]oxane.
| Compound Name | (2R,3S,4S,5R,6R)-2-ethyl-3,4,5-trimethyl-6-[4-methyl-3-[(4-methylphenyl)methyl]phenyl]oxane |
|---|---|
| PubChem CID | 59073453 |
| Molecular Formula | C25H34O |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-ethyl-3,4,5-trimethyl-6-[4-methyl-3-[(4-methylphenyl)methyl]phenyl]oxane |
| SMILES | CC[C@H]1O[C@@H](c2ccc(C)c(Cc3ccc(C)cc3)c2)[C@H](C)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C25H34O/c1-7-24-19(5)18(4)20(6)25(26-24)22-13-10-17(3)23(15-22)14-21-11-8-16(2)9-12-21/h8-13,15,18-20,24-25H,7,14H2,1-6H3/t18-,19-,20+,24+,25+/m0/s1 |
| InChIKey | RZMYIOOYQHIJJA-TVCRXJPTSA-N |
| XLogP | 6.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |