About 4-bromo-2,5-difluoro-3-methylbenzamide
4-bromo-2,5-difluoro-3-methylbenzamide (PubChem CID 59074181) has the molecular formula C8H6BrF2NO
and a molecular weight of 250.04 g/mol. Its IUPAC name is 4-bromo-2,5-difluoro-3-methylbenzamide.
Molecular Properties
| Compound Name | 4-bromo-2,5-difluoro-3-methylbenzamide |
| PubChem CID | 59074181 |
| Molecular Formula | C8H6BrF2NO |
| Molecular Weight | 250.04 g/mol |
| Exact Mass | 248.96 |
| IUPAC Name | 4-bromo-2,5-difluoro-3-methylbenzamide |
| SMILES | Cc1c(F)c(C(N)=O)cc(F)c1Br |
| InChI | InChI=1S/C8H6BrF2NO/c1-3-6(9)5(10)2-4(7(3)11)8(12)13/h2H,1H3,(H2,12,13) |
| InChIKey | JRFYDIIVYQRAOP-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.04 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2,5-difluoro-3-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2,5-difluoro-3-methylbenzamide?
The IUPAC name of 4-bromo-2,5-difluoro-3-methylbenzamide (CID 59074181) is 4-bromo-2,5-difluoro-3-methylbenzamide.
What is the SMILES notation for 4-bromo-2,5-difluoro-3-methylbenzamide?
The canonical SMILES for 4-bromo-2,5-difluoro-3-methylbenzamide is Cc1c(F)c(C(N)=O)cc(F)c1Br.
What is the InChIKey of 4-bromo-2,5-difluoro-3-methylbenzamide?
The InChIKey is JRFYDIIVYQRAOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrF2NO/c1-3-6(9)5(10)2-4(7(3)11)8(12)13/h2H,1H3,(H2,12,13).
What are the key properties of 4-bromo-2,5-difluoro-3-methylbenzamide?
4-bromo-2,5-difluoro-3-methylbenzamide has a molecular weight of 250.04 g/mol, XLogP of 2.13, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2,5-difluoro-3-methylbenzamide is sourced from PubChem (CID 59074181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).