C20H22N4O2S — CID 59074322
7-[4-(aminomethyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1-cyclopropyl-8-methylpyrido[4,3-d]pyrimidine-2,4-dione (PubChem CID 59074322) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is 7-[4-(aminomethyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1-cyclopropyl-8-methylpyrido[4,3-d]pyrimidine-2,4-dione.
| Compound Name | 7-[4-(aminomethyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1-cyclopropyl-8-methylpyrido[4,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 59074322 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 7-[4-(aminomethyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1-cyclopropyl-8-methylpyrido[4,3-d]pyrimidine-2,4-dione |
| SMILES | Cc1c(-c2cc3c(s2)CCCC3CN)ncc2c(=O)[nH]c(=O)n(C3CC3)c12 |
| InChI | InChI=1S/C20H22N4O2S/c1-10-17(16-7-13-11(8-21)3-2-4-15(13)27-16)22-9-14-18(10)24(12-5-6-12)20(26)23-19(14)25/h7,9,11-12H,2-6,8,21H2,1H3,(H,23,25,26) |
| InChIKey | SROXRKUNCHAEMT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 93.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |