C14H19FN6O2 — CID 59074323
4,8-diamino-2-[3-(1-aminoethyl)pyrrolidin-1-yl]-3-fluoro-8H-1,6-naphthyridine-5,7-dione (PubChem CID 59074323) has the molecular formula C14H19FN6O2 and a molecular weight of 322.34 g/mol. Its IUPAC name is 4,8-diamino-2-[3-(1-aminoethyl)pyrrolidin-1-yl]-3-fluoro-8H-1,6-naphthyridine-5,7-dione.
| Compound Name | 4,8-diamino-2-[3-(1-aminoethyl)pyrrolidin-1-yl]-3-fluoro-8H-1,6-naphthyridine-5,7-dione |
|---|---|
| PubChem CID | 59074323 |
| Molecular Formula | C14H19FN6O2 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 4,8-diamino-2-[3-(1-aminoethyl)pyrrolidin-1-yl]-3-fluoro-8H-1,6-naphthyridine-5,7-dione |
| SMILES | CC(N)C1CCN(c2nc3c(c(N)c2F)C(=O)NC(=O)C3N)C1 |
| InChI | InChI=1S/C14H19FN6O2/c1-5(16)6-2-3-21(4-6)12-8(15)9(17)7-11(19-12)10(18)14(23)20-13(7)22/h5-6,10H,2-4,16,18H2,1H3,(H2,17,19)(H,20,22,23) |
| InChIKey | XEVSZNPUAPQRPG-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 140.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|