About 1-[(3S,5S)-5-(methoxymethyl)-1,5-dimethylpyrrolidin-3-yl]ethanone
1-[(3S,5S)-5-(methoxymethyl)-1,5-dimethylpyrrolidin-3-yl]ethanone (PubChem CID 59074642) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is 1-[(3S,5S)-5-(methoxymethyl)-1,5-dimethylpyrrolidin-3-yl]ethanone.
Molecular Properties
| Compound Name | 1-[(3S,5S)-5-(methoxymethyl)-1,5-dimethylpyrrolidin-3-yl]ethanone |
| PubChem CID | 59074642 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 1-[(3S,5S)-5-(methoxymethyl)-1,5-dimethylpyrrolidin-3-yl]ethanone |
| SMILES | COC[C@]1(C)C[C@H](C(C)=O)CN1C |
| InChI | InChI=1S/C10H19NO2/c1-8(12)9-5-10(2,7-13-4)11(3)6-9/h9H,5-7H2,1-4H3/t9-,10-/m0/s1 |
| InChIKey | PVGXLGFPFQTMSH-UWVGGRQHSA-N |
| XLogP | 0.93 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(3S,5S)-5-(methoxymethyl)-1,5-dimethylpyrrolidin-3-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S,5S)-5-(methoxymethyl)-1,5-dimethylpyrrolidin-3-yl]ethanone?
The IUPAC name of 1-[(3S,5S)-5-(methoxymethyl)-1,5-dimethylpyrrolidin-3-yl]ethanone (CID 59074642) is 1-[(3S,5S)-5-(methoxymethyl)-1,5-dimethylpyrrolidin-3-yl]ethanone.
What is the SMILES notation for 1-[(3S,5S)-5-(methoxymethyl)-1,5-dimethylpyrrolidin-3-yl]ethanone?
The canonical SMILES for 1-[(3S,5S)-5-(methoxymethyl)-1,5-dimethylpyrrolidin-3-yl]ethanone is COC[C@]1(C)C[C@H](C(C)=O)CN1C.
What is the InChIKey of 1-[(3S,5S)-5-(methoxymethyl)-1,5-dimethylpyrrolidin-3-yl]ethanone?
The InChIKey is PVGXLGFPFQTMSH-UWVGGRQHSA-N. The full InChI is InChI=1S/C10H19NO2/c1-8(12)9-5-10(2,7-13-4)11(3)6-9/h9H,5-7H2,1-4H3/t9-,10-/m0/s1.
What are the key properties of 1-[(3S,5S)-5-(methoxymethyl)-1,5-dimethylpyrrolidin-3-yl]ethanone?
1-[(3S,5S)-5-(methoxymethyl)-1,5-dimethylpyrrolidin-3-yl]ethanone has a molecular weight of 185.27 g/mol, XLogP of 0.93, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S,5S)-5-(methoxymethyl)-1,5-dimethylpyrrolidin-3-yl]ethanone is sourced from PubChem (CID 59074642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).