About (2R,4S)-2-benzyl-2-(methoxymethyl)-1,4-dimethylpyrrolidine
(2R,4S)-2-benzyl-2-(methoxymethyl)-1,4-dimethylpyrrolidine (PubChem CID 59074646) has the molecular formula C15H23NO
and a molecular weight of 233.36 g/mol. Its IUPAC name is (2R,4S)-2-benzyl-2-(methoxymethyl)-1,4-dimethylpyrrolidine.
Molecular Properties
| Compound Name | (2R,4S)-2-benzyl-2-(methoxymethyl)-1,4-dimethylpyrrolidine |
| PubChem CID | 59074646 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | (2R,4S)-2-benzyl-2-(methoxymethyl)-1,4-dimethylpyrrolidine |
| SMILES | COC[C@]1(Cc2ccccc2)C[C@H](C)CN1C |
| InChI | InChI=1S/C15H23NO/c1-13-9-15(12-17-3,16(2)11-13)10-14-7-5-4-6-8-14/h4-8,13H,9-12H2,1-3H3/t13-,15+/m0/s1 |
| InChIKey | ZGVXPZBREVSVHJ-DZGCQCFKSA-N |
| XLogP | 2.59 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R,4S)-2-benzyl-2-(methoxymethyl)-1,4-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4S)-2-benzyl-2-(methoxymethyl)-1,4-dimethylpyrrolidine?
The IUPAC name of (2R,4S)-2-benzyl-2-(methoxymethyl)-1,4-dimethylpyrrolidine (CID 59074646) is (2R,4S)-2-benzyl-2-(methoxymethyl)-1,4-dimethylpyrrolidine.
What is the SMILES notation for (2R,4S)-2-benzyl-2-(methoxymethyl)-1,4-dimethylpyrrolidine?
The canonical SMILES for (2R,4S)-2-benzyl-2-(methoxymethyl)-1,4-dimethylpyrrolidine is COC[C@]1(Cc2ccccc2)C[C@H](C)CN1C.
What is the InChIKey of (2R,4S)-2-benzyl-2-(methoxymethyl)-1,4-dimethylpyrrolidine?
The InChIKey is ZGVXPZBREVSVHJ-DZGCQCFKSA-N. The full InChI is InChI=1S/C15H23NO/c1-13-9-15(12-17-3,16(2)11-13)10-14-7-5-4-6-8-14/h4-8,13H,9-12H2,1-3H3/t13-,15+/m0/s1.
What are the key properties of (2R,4S)-2-benzyl-2-(methoxymethyl)-1,4-dimethylpyrrolidine?
(2R,4S)-2-benzyl-2-(methoxymethyl)-1,4-dimethylpyrrolidine has a molecular weight of 233.36 g/mol, XLogP of 2.59, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4S)-2-benzyl-2-(methoxymethyl)-1,4-dimethylpyrrolidine is sourced from PubChem (CID 59074646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).