1-O-ethyl 7-O-methyl (E,6R)-2-fluoro-6-methylhept-2-enedioate

C11H17FO4 — CID 59074904

IUPAC1-O-ethyl 7-O-methyl (E,6R)-2-fluoro-6-methylhept-2-enedioate
SMILESCCOC(=O)/C(F)=C\CC[C@@H](C)C(=O)OC
InChIInChI=1S/C11H17FO4/c1-4-16-11(14)9(12)7-5-6-8(2)10(13)15-3/h7-8H,4-6H2,1-3H3/b9-7+/t8-/m1/s1
InChIKeyXOAXFVNGHJCRLE-KGOFQHAKSA-N
MW232.25 g/mol
LogP1.99
Rot. Bonds6

About 1-O-ethyl 7-O-methyl (E,6R)-2-fluoro-6-methylhept-2-enedioate

1-O-ethyl 7-O-methyl (E,6R)-2-fluoro-6-methylhept-2-enedioate (PubChem CID 59074904) has the molecular formula C11H17FO4 and a molecular weight of 232.25 g/mol. Its IUPAC name is 1-O-ethyl 7-O-methyl (E,6R)-2-fluoro-6-methylhept-2-enedioate.

Molecular Properties

Compound Name1-O-ethyl 7-O-methyl (E,6R)-2-fluoro-6-methylhept-2-enedioate
PubChem CID59074904
Molecular FormulaC11H17FO4
Molecular Weight232.25 g/mol
Exact Mass232.11
IUPAC Name1-O-ethyl 7-O-methyl (E,6R)-2-fluoro-6-methylhept-2-enedioate
SMILESCCOC(=O)/C(F)=C\CC[C@@H](C)C(=O)OC
InChIInChI=1S/C11H17FO4/c1-4-16-11(14)9(12)7-5-6-8(2)10(13)15-3/h7-8H,4-6H2,1-3H3/b9-7+/t8-/m1/s1
InChIKeyXOAXFVNGHJCRLE-KGOFQHAKSA-N
XLogP1.99
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.25
LogP ≤ 51.99
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 1-O-ethyl 7-O-methyl (E,6R)-2-fluoro-6-methylhept-2-enedioate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-O-ethyl 7-O-methyl (E,6R)-2-fluoro-6-methylhept-2-enedioate?
The IUPAC name of 1-O-ethyl 7-O-methyl (E,6R)-2-fluoro-6-methylhept-2-enedioate (CID 59074904) is 1-O-ethyl 7-O-methyl (E,6R)-2-fluoro-6-methylhept-2-enedioate.
What is the SMILES notation for 1-O-ethyl 7-O-methyl (E,6R)-2-fluoro-6-methylhept-2-enedioate?
The canonical SMILES for 1-O-ethyl 7-O-methyl (E,6R)-2-fluoro-6-methylhept-2-enedioate is CCOC(=O)/C(F)=C\CC[C@@H](C)C(=O)OC.
What is the InChIKey of 1-O-ethyl 7-O-methyl (E,6R)-2-fluoro-6-methylhept-2-enedioate?
The InChIKey is XOAXFVNGHJCRLE-KGOFQHAKSA-N. The full InChI is InChI=1S/C11H17FO4/c1-4-16-11(14)9(12)7-5-6-8(2)10(13)15-3/h7-8H,4-6H2,1-3H3/b9-7+/t8-/m1/s1.
What are the key properties of 1-O-ethyl 7-O-methyl (E,6R)-2-fluoro-6-methylhept-2-enedioate?
1-O-ethyl 7-O-methyl (E,6R)-2-fluoro-6-methylhept-2-enedioate has a molecular weight of 232.25 g/mol, XLogP of 1.99, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 7-O-methyl (E,6R)-2-fluoro-6-methylhept-2-enedioate is sourced from PubChem (CID 59074904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).