C11H14N2O — CID 59074969
1-(2-pyridin-3-ylethyl)pyrrolidin-2-one (PubChem CID 59074969) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 1-(2-pyridin-3-ylethyl)pyrrolidin-2-one.
| Compound Name | 1-(2-pyridin-3-ylethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 59074969 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 1-(2-pyridin-3-ylethyl)pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCc1cccnc1 |
| InChI | InChI=1S/C11H14N2O/c14-11-4-2-7-13(11)8-5-10-3-1-6-12-9-10/h1,3,6,9H,2,4-5,7-8H2 |
| InChIKey | HXTZGKCBKNOFAG-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |