About ethyl 7-[(5R)-5-formyl-3,3-dimethyl-2-oxopyrrolidin-1-yl]heptanoate
ethyl 7-[(5R)-5-formyl-3,3-dimethyl-2-oxopyrrolidin-1-yl]heptanoate (PubChem CID 59075101) has the molecular formula C16H27NO4
and a molecular weight of 297.40 g/mol. Its IUPAC name is ethyl 7-[(5R)-5-formyl-3,3-dimethyl-2-oxopyrrolidin-1-yl]heptanoate.
Molecular Properties
| Compound Name | ethyl 7-[(5R)-5-formyl-3,3-dimethyl-2-oxopyrrolidin-1-yl]heptanoate |
| PubChem CID | 59075101 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | ethyl 7-[(5R)-5-formyl-3,3-dimethyl-2-oxopyrrolidin-1-yl]heptanoate |
| SMILES | CCOC(=O)CCCCCCN1C(=O)C(C)(C)C[C@@H]1C=O |
| InChI | InChI=1S/C16H27NO4/c1-4-21-14(19)9-7-5-6-8-10-17-13(12-18)11-16(2,3)15(17)20/h12-13H,4-11H2,1-3H3/t13-/m1/s1 |
| InChIKey | QJLXSSWUEGVQBV-CYBMUJFWSA-N |
| XLogP | 2.33 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 7-[(5R)-5-formyl-3,3-dimethyl-2-oxopyrrolidin-1-yl]heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-[(5R)-5-formyl-3,3-dimethyl-2-oxopyrrolidin-1-yl]heptanoate?
The IUPAC name of ethyl 7-[(5R)-5-formyl-3,3-dimethyl-2-oxopyrrolidin-1-yl]heptanoate (CID 59075101) is ethyl 7-[(5R)-5-formyl-3,3-dimethyl-2-oxopyrrolidin-1-yl]heptanoate.
What is the SMILES notation for ethyl 7-[(5R)-5-formyl-3,3-dimethyl-2-oxopyrrolidin-1-yl]heptanoate?
The canonical SMILES for ethyl 7-[(5R)-5-formyl-3,3-dimethyl-2-oxopyrrolidin-1-yl]heptanoate is CCOC(=O)CCCCCCN1C(=O)C(C)(C)C[C@@H]1C=O.
What is the InChIKey of ethyl 7-[(5R)-5-formyl-3,3-dimethyl-2-oxopyrrolidin-1-yl]heptanoate?
The InChIKey is QJLXSSWUEGVQBV-CYBMUJFWSA-N. The full InChI is InChI=1S/C16H27NO4/c1-4-21-14(19)9-7-5-6-8-10-17-13(12-18)11-16(2,3)15(17)20/h12-13H,4-11H2,1-3H3/t13-/m1/s1.
What are the key properties of ethyl 7-[(5R)-5-formyl-3,3-dimethyl-2-oxopyrrolidin-1-yl]heptanoate?
ethyl 7-[(5R)-5-formyl-3,3-dimethyl-2-oxopyrrolidin-1-yl]heptanoate has a molecular weight of 297.40 g/mol, XLogP of 2.33, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-[(5R)-5-formyl-3,3-dimethyl-2-oxopyrrolidin-1-yl]heptanoate is sourced from PubChem (CID 59075101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).