C28H22BrCl2N3O4 — CID 59075228
2-[3-[(5R)-5-[(4-bromophenyl)methyl]-3-(3,5-dichlorophenyl)-5-methyl-2,4-dioxoimidazolidin-1-yl]propyl]isoindole-1,3-dione (PubChem CID 59075228) has the molecular formula C28H22BrCl2N3O4 and a molecular weight of 615.31 g/mol. Its IUPAC name is 2-[3-[(5R)-5-[(4-bromophenyl)methyl]-3-(3,5-dichlorophenyl)-5-methyl-2,4-dioxoimidazolidin-1-yl]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[(5R)-5-[(4-bromophenyl)methyl]-3-(3,5-dichlorophenyl)-5-methyl-2,4-dioxoimidazolidin-1-yl]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 59075228 |
| Molecular Formula | C28H22BrCl2N3O4 |
| Molecular Weight | 615.31 g/mol |
| Exact Mass | 613.02 |
| IUPAC Name | 2-[3-[(5R)-5-[(4-bromophenyl)methyl]-3-(3,5-dichlorophenyl)-5-methyl-2,4-dioxoimidazolidin-1-yl]propyl]isoindole-1,3-dione |
| SMILES | C[C@@]1(Cc2ccc(Br)cc2)C(=O)N(c2cc(Cl)cc(Cl)c2)C(=O)N1CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C28H22BrCl2N3O4/c1-28(16-17-7-9-18(29)10-8-17)26(37)34(21-14-19(30)13-20(31)15-21)27(38)33(28)12-4-11-32-24(35)22-5-2-3-6-23(22)25(32)36/h2-3,5-10,13-15H,4,11-12,16H2,1H3/t28-/m1/s1 |
| InChIKey | UYHVGXKOLCLMJK-MUUNZHRXSA-N |
| XLogP | 6.21 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.31 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|