C9H15ClFNO — CID 59075854
(4S)-4-[(Z)-3-chloro-2-fluoroprop-1-enyl]-2,2,3-trimethyl-1,3-oxazolidine (PubChem CID 59075854) has the molecular formula C9H15ClFNO and a molecular weight of 207.68 g/mol. Its IUPAC name is (4S)-4-[(Z)-3-chloro-2-fluoroprop-1-enyl]-2,2,3-trimethyl-1,3-oxazolidine.
| Compound Name | (4S)-4-[(Z)-3-chloro-2-fluoroprop-1-enyl]-2,2,3-trimethyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 59075854 |
| Molecular Formula | C9H15ClFNO |
| Molecular Weight | 207.68 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | (4S)-4-[(Z)-3-chloro-2-fluoroprop-1-enyl]-2,2,3-trimethyl-1,3-oxazolidine |
| SMILES | CN1[C@@H](/C=C(\F)CCl)COC1(C)C |
| InChI | InChI=1S/C9H15ClFNO/c1-9(2)12(3)8(6-13-9)4-7(11)5-10/h4,8H,5-6H2,1-3H3/b7-4-/t8-/m0/s1 |
| InChIKey | VVZBCVJYRWLJQF-NZGHECTNSA-N |
| XLogP | 2.15 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.68 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|