About hydroxy-[(2R)-1-methylpiperidin-2-yl]methanesulfonic acid;tungsten
hydroxy-[(2R)-1-methylpiperidin-2-yl]methanesulfonic acid;tungsten (PubChem CID 59075947) has the molecular formula C7H15NO4SW
and a molecular weight of 393.11 g/mol. Its IUPAC name is hydroxy-[(2R)-1-methylpiperidin-2-yl]methanesulfonic acid;tungsten.
Molecular Properties
| Compound Name | hydroxy-[(2R)-1-methylpiperidin-2-yl]methanesulfonic acid;tungsten |
| PubChem CID | 59075947 |
| Molecular Formula | C7H15NO4SW |
| Molecular Weight | 393.11 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | hydroxy-[(2R)-1-methylpiperidin-2-yl]methanesulfonic acid;tungsten |
| SMILES | CN1CCCC[C@@H]1C(O)S(=O)(=O)O.[W] |
| InChI | InChI=1S/C7H15NO4S.W/c1-8-5-3-2-4-6(8)7(9)13(10,11)12;/h6-7,9H,2-5H2,1H3,(H,10,11,12);/t6-,7?;/m1./s1 |
| InChIKey | TXNBAAOXDZJSBN-JVEOKNEYSA-N |
| XLogP | -0.33 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.11 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze hydroxy-[(2R)-1-methylpiperidin-2-yl]methanesulfonic acid;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy-[(2R)-1-methylpiperidin-2-yl]methanesulfonic acid;tungsten?
The IUPAC name of hydroxy-[(2R)-1-methylpiperidin-2-yl]methanesulfonic acid;tungsten (CID 59075947) is hydroxy-[(2R)-1-methylpiperidin-2-yl]methanesulfonic acid;tungsten.
What is the SMILES notation for hydroxy-[(2R)-1-methylpiperidin-2-yl]methanesulfonic acid;tungsten?
The canonical SMILES for hydroxy-[(2R)-1-methylpiperidin-2-yl]methanesulfonic acid;tungsten is CN1CCCC[C@@H]1C(O)S(=O)(=O)O.[W].
What is the InChIKey of hydroxy-[(2R)-1-methylpiperidin-2-yl]methanesulfonic acid;tungsten?
The InChIKey is TXNBAAOXDZJSBN-JVEOKNEYSA-N. The full InChI is InChI=1S/C7H15NO4S.W/c1-8-5-3-2-4-6(8)7(9)13(10,11)12;/h6-7,9H,2-5H2,1H3,(H,10,11,12);/t6-,7?;/m1./s1.
What are the key properties of hydroxy-[(2R)-1-methylpiperidin-2-yl]methanesulfonic acid;tungsten?
hydroxy-[(2R)-1-methylpiperidin-2-yl]methanesulfonic acid;tungsten has a molecular weight of 393.11 g/mol, XLogP of -0.33, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy-[(2R)-1-methylpiperidin-2-yl]methanesulfonic acid;tungsten is sourced from PubChem (CID 59075947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).