C13H19NO4SW — CID 59075959
[(2R)-1-benzylpiperidin-2-yl]-hydroxymethanesulfonic acid;tungsten (PubChem CID 59075959) has the molecular formula C13H19NO4SW and a molecular weight of 469.21 g/mol. Its IUPAC name is [(2R)-1-benzylpiperidin-2-yl]-hydroxymethanesulfonic acid;tungsten.
| Compound Name | [(2R)-1-benzylpiperidin-2-yl]-hydroxymethanesulfonic acid;tungsten |
|---|---|
| PubChem CID | 59075959 |
| Molecular Formula | C13H19NO4SW |
| Molecular Weight | 469.21 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | [(2R)-1-benzylpiperidin-2-yl]-hydroxymethanesulfonic acid;tungsten |
| SMILES | O=S(=O)(O)C(O)[C@H]1CCCCN1Cc1ccccc1.[W] |
| InChI | InChI=1S/C13H19NO4S.W/c15-13(19(16,17)18)12-8-4-5-9-14(12)10-11-6-2-1-3-7-11;/h1-3,6-7,12-13,15H,4-5,8-10H2,(H,16,17,18);/t12-,13?;/m1./s1 |
| InChIKey | CTERWGBPEUHRBU-QPWPOBFOSA-N |
| XLogP | 1.24 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.21 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|