About 2,4-dihydroxy-1-[4-(sulfinatoamino)cyclohexyl]benzene;yttrium
2,4-dihydroxy-1-[4-(sulfinatoamino)cyclohexyl]benzene;yttrium (PubChem CID 59076240) has the molecular formula C12H16NO4SY-
and a molecular weight of 359.24 g/mol. Its IUPAC name is 2,4-dihydroxy-1-[4-(sulfinatoamino)cyclohexyl]benzene;yttrium.
Molecular Properties
| Compound Name | 2,4-dihydroxy-1-[4-(sulfinatoamino)cyclohexyl]benzene;yttrium |
| PubChem CID | 59076240 |
| Molecular Formula | C12H16NO4SY- |
| Molecular Weight | 359.24 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | 2,4-dihydroxy-1-[4-(sulfinatoamino)cyclohexyl]benzene;yttrium |
| SMILES | O=S([O-])NC1CCC(c2ccc(O)cc2O)CC1.[Y] |
| InChI | InChI=1S/C12H17NO4S.Y/c14-10-5-6-11(12(15)7-10)8-1-3-9(4-2-8)13-18(16)17;/h5-9,13-15H,1-4H2,(H,16,17);/p-1 |
| InChIKey | XSNSHQQHKCQREM-UHFFFAOYSA-M |
| XLogP | 1.51 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dihydroxy-1-[4-(sulfinatoamino)cyclohexyl]benzene;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dihydroxy-1-[4-(sulfinatoamino)cyclohexyl]benzene;yttrium?
The IUPAC name of 2,4-dihydroxy-1-[4-(sulfinatoamino)cyclohexyl]benzene;yttrium (CID 59076240) is 2,4-dihydroxy-1-[4-(sulfinatoamino)cyclohexyl]benzene;yttrium.
What is the SMILES notation for 2,4-dihydroxy-1-[4-(sulfinatoamino)cyclohexyl]benzene;yttrium?
The canonical SMILES for 2,4-dihydroxy-1-[4-(sulfinatoamino)cyclohexyl]benzene;yttrium is O=S([O-])NC1CCC(c2ccc(O)cc2O)CC1.[Y].
What is the InChIKey of 2,4-dihydroxy-1-[4-(sulfinatoamino)cyclohexyl]benzene;yttrium?
The InChIKey is XSNSHQQHKCQREM-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H17NO4S.Y/c14-10-5-6-11(12(15)7-10)8-1-3-9(4-2-8)13-18(16)17;/h5-9,13-15H,1-4H2,(H,16,17);/p-1.
What are the key properties of 2,4-dihydroxy-1-[4-(sulfinatoamino)cyclohexyl]benzene;yttrium?
2,4-dihydroxy-1-[4-(sulfinatoamino)cyclohexyl]benzene;yttrium has a molecular weight of 359.24 g/mol, XLogP of 1.51, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dihydroxy-1-[4-(sulfinatoamino)cyclohexyl]benzene;yttrium is sourced from PubChem (CID 59076240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).