About 5-amino-4-ethyl-1-methyl-1,2,4-triazolidine-3-thiol
5-amino-4-ethyl-1-methyl-1,2,4-triazolidine-3-thiol (PubChem CID 59076309) has the molecular formula C5H14N4S
and a molecular weight of 162.26 g/mol. Its IUPAC name is 5-amino-4-ethyl-1-methyl-1,2,4-triazolidine-3-thiol.
Molecular Properties
| Compound Name | 5-amino-4-ethyl-1-methyl-1,2,4-triazolidine-3-thiol |
| PubChem CID | 59076309 |
| Molecular Formula | C5H14N4S |
| Molecular Weight | 162.26 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 5-amino-4-ethyl-1-methyl-1,2,4-triazolidine-3-thiol |
| SMILES | CCN1C(S)NN(C)C1N |
| InChI | InChI=1S/C5H14N4S/c1-3-9-4(6)8(2)7-5(9)10/h4-5,7,10H,3,6H2,1-2H3 |
| InChIKey | GNSQBXNYSCXNGI-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.26 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-4-ethyl-1-methyl-1,2,4-triazolidine-3-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-4-ethyl-1-methyl-1,2,4-triazolidine-3-thiol?
The IUPAC name of 5-amino-4-ethyl-1-methyl-1,2,4-triazolidine-3-thiol (CID 59076309) is 5-amino-4-ethyl-1-methyl-1,2,4-triazolidine-3-thiol.
What is the SMILES notation for 5-amino-4-ethyl-1-methyl-1,2,4-triazolidine-3-thiol?
The canonical SMILES for 5-amino-4-ethyl-1-methyl-1,2,4-triazolidine-3-thiol is CCN1C(S)NN(C)C1N.
What is the InChIKey of 5-amino-4-ethyl-1-methyl-1,2,4-triazolidine-3-thiol?
The InChIKey is GNSQBXNYSCXNGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14N4S/c1-3-9-4(6)8(2)7-5(9)10/h4-5,7,10H,3,6H2,1-2H3.
What are the key properties of 5-amino-4-ethyl-1-methyl-1,2,4-triazolidine-3-thiol?
5-amino-4-ethyl-1-methyl-1,2,4-triazolidine-3-thiol has a molecular weight of 162.26 g/mol, XLogP of -0.79, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4-ethyl-1-methyl-1,2,4-triazolidine-3-thiol is sourced from PubChem (CID 59076309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).