C16H27NO4 — CID 59076477
2-[(1R,5R,6R)-6-acetamido-3-methyl-5-pentan-3-yloxycyclohex-3-en-1-yl]acetic acid (PubChem CID 59076477) has the molecular formula C16H27NO4 and a molecular weight of 297.39 g/mol. Its IUPAC name is 2-[(1R,5R,6R)-6-acetamido-3-methyl-5-pentan-3-yloxycyclohex-3-en-1-yl]acetic acid.
| Compound Name | 2-[(1R,5R,6R)-6-acetamido-3-methyl-5-pentan-3-yloxycyclohex-3-en-1-yl]acetic acid |
|---|---|
| PubChem CID | 59076477 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 2-[(1R,5R,6R)-6-acetamido-3-methyl-5-pentan-3-yloxycyclohex-3-en-1-yl]acetic acid |
| SMILES | CCC(CC)O[C@@H]1C=C(C)C[C@H](CC(=O)O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C16H27NO4/c1-5-13(6-2)21-14-8-10(3)7-12(9-15(19)20)16(14)17-11(4)18/h8,12-14,16H,5-7,9H2,1-4H3,(H,17,18)(H,19,20)/t12-,14-,16-/m1/s1 |
| InChIKey | PUEMGXZAFZNYTP-XNRPHZJLSA-N |
| XLogP | 2.51 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|