C13H20O7 — CID 59076489
methyl (3aR,5S,7R,7aR)-7-acetyloxy-5-hydroxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxylate (PubChem CID 59076489) has the molecular formula C13H20O7 and a molecular weight of 288.30 g/mol. Its IUPAC name is methyl (3aR,5S,7R,7aR)-7-acetyloxy-5-hydroxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxylate.
| Compound Name | methyl (3aR,5S,7R,7aR)-7-acetyloxy-5-hydroxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 59076489 |
| Molecular Formula | C13H20O7 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | methyl (3aR,5S,7R,7aR)-7-acetyloxy-5-hydroxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-5-carboxylate |
| SMILES | COC(=O)[C@@]1(O)C[C@@H](OC(C)=O)[C@@H]2OC(C)(C)O[C@@H]2C1 |
| InChI | InChI=1S/C13H20O7/c1-7(14)18-8-5-13(16,11(15)17-4)6-9-10(8)20-12(2,3)19-9/h8-10,16H,5-6H2,1-4H3/t8-,9-,10+,13-/m1/s1 |
| InChIKey | WCQSTKKDIODLLS-ORXSELOVSA-N |
| XLogP | 0.14 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |