C16H29NO4 — CID 59076491
N-[(1R,2R,6R)-6-(1-ethoxyethoxy)-4-methyl-2-propan-2-yloxycyclohex-3-en-1-yl]acetamide (PubChem CID 59076491) has the molecular formula C16H29NO4 and a molecular weight of 299.41 g/mol. Its IUPAC name is N-[(1R,2R,6R)-6-(1-ethoxyethoxy)-4-methyl-2-propan-2-yloxycyclohex-3-en-1-yl]acetamide.
| Compound Name | N-[(1R,2R,6R)-6-(1-ethoxyethoxy)-4-methyl-2-propan-2-yloxycyclohex-3-en-1-yl]acetamide |
|---|---|
| PubChem CID | 59076491 |
| Molecular Formula | C16H29NO4 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | N-[(1R,2R,6R)-6-(1-ethoxyethoxy)-4-methyl-2-propan-2-yloxycyclohex-3-en-1-yl]acetamide |
| SMILES | CCOC(C)O[C@@H]1CC(C)=C[C@@H](OC(C)C)[C@@H]1NC(C)=O |
| InChI | InChI=1S/C16H29NO4/c1-7-19-13(6)21-15-9-11(4)8-14(20-10(2)3)16(15)17-12(5)18/h8,10,13-16H,7,9H2,1-6H3,(H,17,18)/t13?,14-,15-,16+/m1/s1 |
| InChIKey | YPCMRHAACWRGDS-VIYLOZMYSA-N |
| XLogP | 2.40 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|