C16H25NO5 — CID 59076494
2-tritioethyl (3R,4R,5R)-4-acetamido-5-(2-oxoethyl)-3-propan-2-yloxycyclohexene-1-carboxylate (PubChem CID 59076494) has the molecular formula C16H25NO5 and a molecular weight of 313.39 g/mol. Its IUPAC name is 2-tritioethyl (3R,4R,5R)-4-acetamido-5-(2-oxoethyl)-3-propan-2-yloxycyclohexene-1-carboxylate.
| Compound Name | 2-tritioethyl (3R,4R,5R)-4-acetamido-5-(2-oxoethyl)-3-propan-2-yloxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 59076494 |
| Molecular Formula | C16H25NO5 |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 2-tritioethyl (3R,4R,5R)-4-acetamido-5-(2-oxoethyl)-3-propan-2-yloxycyclohexene-1-carboxylate |
| SMILES | [3H]CCOC(=O)C1=C[C@@H](OC(C)C)[C@H](NC(C)=O)[C@@H](CC=O)C1 |
| InChI | InChI=1S/C16H25NO5/c1-5-21-16(20)13-8-12(6-7-18)15(17-11(4)19)14(9-13)22-10(2)3/h7,9-10,12,14-15H,5-6,8H2,1-4H3,(H,17,19)/t12-,14+,15+/m0/s1/i1T |
| InChIKey | HELMPZXQTLVMKE-OQMBJKHDSA-N |
| XLogP | 1.38 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|