C12H19BO3S — CID 59076519
[(1R,2S,6R)-6-[[deuterio(tritio)boranyl]methylsulfanyloxy]-2-ethenyl-4-methylcyclohex-3-en-1-yl] acetate (PubChem CID 59076519) has the molecular formula C12H19BO3S and a molecular weight of 257.17 g/mol. Its IUPAC name is [(1R,2S,6R)-6-[[deuterio(tritio)boranyl]methylsulfanyloxy]-2-ethenyl-4-methylcyclohex-3-en-1-yl] acetate.
| Compound Name | [(1R,2S,6R)-6-[[deuterio(tritio)boranyl]methylsulfanyloxy]-2-ethenyl-4-methylcyclohex-3-en-1-yl] acetate |
|---|---|
| PubChem CID | 59076519 |
| Molecular Formula | C12H19BO3S |
| Molecular Weight | 257.17 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | [(1R,2S,6R)-6-[[deuterio(tritio)boranyl]methylsulfanyloxy]-2-ethenyl-4-methylcyclohex-3-en-1-yl] acetate |
| SMILES | [2H]B([3H])CSO[C@@H]1CC(C)=C[C@H](C=C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C12H19BO3S/c1-4-10-5-8(2)6-11(16-17-7-13)12(10)15-9(3)14/h4-5,10-12H,1,6-7,13H2,2-3H3/t10-,11+,12+/m0/s1/i13TD |
| InChIKey | URABNWSELUCWCW-IGZXTPKZSA-N |
| XLogP | 1.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.17 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|