C17H29NO3 — CID 59076546
N-[(1R,2R,6R)-4-methyl-6-(oxiran-2-ylmethyl)-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide (PubChem CID 59076546) has the molecular formula C17H29NO3 and a molecular weight of 295.42 g/mol. Its IUPAC name is N-[(1R,2R,6R)-4-methyl-6-(oxiran-2-ylmethyl)-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide.
| Compound Name | N-[(1R,2R,6R)-4-methyl-6-(oxiran-2-ylmethyl)-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide |
|---|---|
| PubChem CID | 59076546 |
| Molecular Formula | C17H29NO3 |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | N-[(1R,2R,6R)-4-methyl-6-(oxiran-2-ylmethyl)-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide |
| SMILES | CCC(CC)O[C@@H]1C=C(C)C[C@H](CC2CO2)[C@H]1NC(C)=O |
| InChI | InChI=1S/C17H29NO3/c1-5-14(6-2)21-16-8-11(3)7-13(9-15-10-20-15)17(16)18-12(4)19/h8,13-17H,5-7,9-10H2,1-4H3,(H,18,19)/t13-,15?,16-,17-/m1/s1 |
| InChIKey | NMBDCAMLDAAXDH-SCLBYZPPSA-N |
| XLogP | 2.82 |
| TPSA | 50.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|