C17H31NO4 — CID 59076565
N-[(1R,2R,6R)-6-(2,3-dihydroxypropyl)-4-methyl-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide (PubChem CID 59076565) has the molecular formula C17H31NO4 and a molecular weight of 313.44 g/mol. Its IUPAC name is N-[(1R,2R,6R)-6-(2,3-dihydroxypropyl)-4-methyl-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide.
| Compound Name | N-[(1R,2R,6R)-6-(2,3-dihydroxypropyl)-4-methyl-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide |
|---|---|
| PubChem CID | 59076565 |
| Molecular Formula | C17H31NO4 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | N-[(1R,2R,6R)-6-(2,3-dihydroxypropyl)-4-methyl-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide |
| SMILES | CCC(CC)O[C@@H]1C=C(C)C[C@H](CC(O)CO)[C@H]1NC(C)=O |
| InChI | InChI=1S/C17H31NO4/c1-5-15(6-2)22-16-8-11(3)7-13(9-14(21)10-19)17(16)18-12(4)20/h8,13-17,19,21H,5-7,9-10H2,1-4H3,(H,18,20)/t13-,14?,16-,17-/m1/s1 |
| InChIKey | DHBGIWLMXBQICC-KLCSZFHISA-N |
| XLogP | 1.77 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|