C15H25NO3 — CID 59076569
N-[(1R,2R,6R)-4-methyl-6-(oxiran-2-ylmethyl)-2-propan-2-yloxycyclohex-3-en-1-yl]acetamide (PubChem CID 59076569) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is N-[(1R,2R,6R)-4-methyl-6-(oxiran-2-ylmethyl)-2-propan-2-yloxycyclohex-3-en-1-yl]acetamide.
| Compound Name | N-[(1R,2R,6R)-4-methyl-6-(oxiran-2-ylmethyl)-2-propan-2-yloxycyclohex-3-en-1-yl]acetamide |
|---|---|
| PubChem CID | 59076569 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | N-[(1R,2R,6R)-4-methyl-6-(oxiran-2-ylmethyl)-2-propan-2-yloxycyclohex-3-en-1-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1[C@@H](CC2CO2)CC(C)=C[C@H]1OC(C)C |
| InChI | InChI=1S/C15H25NO3/c1-9(2)19-14-6-10(3)5-12(7-13-8-18-13)15(14)16-11(4)17/h6,9,12-15H,5,7-8H2,1-4H3,(H,16,17)/t12-,13?,14-,15-/m1/s1 |
| InChIKey | XJXCFZLAIKOZME-RNLVXLIHSA-N |
| XLogP | 2.04 |
| TPSA | 50.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|