C14H23NO2 — CID 59076572
N-[(1R,2S,6R)-2-ethenyl-4-methyl-6-propan-2-yloxycyclohex-3-en-1-yl]acetamide (PubChem CID 59076572) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is N-[(1R,2S,6R)-2-ethenyl-4-methyl-6-propan-2-yloxycyclohex-3-en-1-yl]acetamide.
| Compound Name | N-[(1R,2S,6R)-2-ethenyl-4-methyl-6-propan-2-yloxycyclohex-3-en-1-yl]acetamide |
|---|---|
| PubChem CID | 59076572 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | N-[(1R,2S,6R)-2-ethenyl-4-methyl-6-propan-2-yloxycyclohex-3-en-1-yl]acetamide |
| SMILES | C=C[C@H]1C=C(C)C[C@@H](OC(C)C)[C@@H]1NC(C)=O |
| InChI | InChI=1S/C14H23NO2/c1-6-12-7-10(4)8-13(17-9(2)3)14(12)15-11(5)16/h6-7,9,12-14H,1,8H2,2-5H3,(H,15,16)/t12-,13+,14+/m0/s1 |
| InChIKey | XNEQLPSHPZRDOX-BFHYXJOUSA-N |
| XLogP | 2.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|