C36H44N6O4 — CID 59077000
tert-butyl N-[(5R)-5-amino-6-[2-[3-hydroxy-3-phenyl-2-pyridin-2-yl-1-(pyridin-2-ylamino)propyl]anilino]-6-oxohexyl]carbamate (PubChem CID 59077000) has the molecular formula C36H44N6O4 and a molecular weight of 624.79 g/mol. Its IUPAC name is tert-butyl N-[(5R)-5-amino-6-[2-[3-hydroxy-3-phenyl-2-pyridin-2-yl-1-(pyridin-2-ylamino)propyl]anilino]-6-oxohexyl]carbamate.
| Compound Name | tert-butyl N-[(5R)-5-amino-6-[2-[3-hydroxy-3-phenyl-2-pyridin-2-yl-1-(pyridin-2-ylamino)propyl]anilino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 59077000 |
| Molecular Formula | C36H44N6O4 |
| Molecular Weight | 624.79 g/mol |
| Exact Mass | 624.34 |
| IUPAC Name | tert-butyl N-[(5R)-5-amino-6-[2-[3-hydroxy-3-phenyl-2-pyridin-2-yl-1-(pyridin-2-ylamino)propyl]anilino]-6-oxohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@@H](N)C(=O)Nc1ccccc1C(Nc1ccccn1)C(c1ccccn1)C(O)c1ccccc1 |
| InChI | InChI=1S/C36H44N6O4/c1-36(2,3)46-35(45)40-24-12-9-18-27(37)34(44)41-28-19-8-7-17-26(28)32(42-30-21-11-14-23-39-30)31(29-20-10-13-22-38-29)33(43)25-15-5-4-6-16-25/h4-8,10-11,13-17,19-23,27,31-33,43H,9,12,18,24,37H2,1-3H3,(H,39,42)(H,40,45)(H,41,44)/t27-,31?,32?,33?/m1/s1 |
| InChIKey | BBEQHLSWLGPAMA-KKKCPAOKSA-N |
| XLogP | 6.11 |
| TPSA | 151.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.79 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|