C15H15Cl3N2O — CID 59077089
(2R)-1-[6-chloro-5-[(2,6-dichlorophenyl)methoxy]-2-pyridinyl]propan-2-amine (PubChem CID 59077089) has the molecular formula C15H15Cl3N2O and a molecular weight of 345.66 g/mol. Its IUPAC name is (2R)-1-[6-chloro-5-[(2,6-dichlorophenyl)methoxy]-2-pyridinyl]propan-2-amine.
| Compound Name | (2R)-1-[6-chloro-5-[(2,6-dichlorophenyl)methoxy]-2-pyridinyl]propan-2-amine |
|---|---|
| PubChem CID | 59077089 |
| Molecular Formula | C15H15Cl3N2O |
| Molecular Weight | 345.66 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | (2R)-1-[6-chloro-5-[(2,6-dichlorophenyl)methoxy]-2-pyridinyl]propan-2-amine |
| SMILES | C[C@@H](N)Cc1ccc(OCc2c(Cl)cccc2Cl)c(Cl)n1 |
| InChI | InChI=1S/C15H15Cl3N2O/c1-9(19)7-10-5-6-14(15(18)20-10)21-8-11-12(16)3-2-4-13(11)17/h2-6,9H,7-8,19H2,1H3/t9-/m1/s1 |
| InChIKey | XGHHSIINYYMWSQ-SECBINFHSA-N |
| XLogP | 4.51 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.66 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|