C5H11ClNOP — CID 59077190
(4S,5R)-2-chloro-3,4,5-trimethyl-1,3,2-oxazaphospholidine (PubChem CID 59077190) has the molecular formula C5H11ClNOP and a molecular weight of 167.58 g/mol. Its IUPAC name is (4S,5R)-2-chloro-3,4,5-trimethyl-1,3,2-oxazaphospholidine.
| Compound Name | (4S,5R)-2-chloro-3,4,5-trimethyl-1,3,2-oxazaphospholidine |
|---|---|
| PubChem CID | 59077190 |
| Molecular Formula | C5H11ClNOP |
| Molecular Weight | 167.58 g/mol |
| Exact Mass | 167.03 |
| IUPAC Name | (4S,5R)-2-chloro-3,4,5-trimethyl-1,3,2-oxazaphospholidine |
| SMILES | C[C@H]1OP(Cl)N(C)[C@H]1C |
| InChI | InChI=1S/C5H11ClNOP/c1-4-5(2)8-9(6)7(4)3/h4-5H,1-3H3/t4-,5+,9?/m0/s1 |
| InChIKey | NGANQKOHMRWOOG-UYLKLXDISA-N |
| XLogP | 2.19 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.58 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|