C18H23ClO — CID 59077274
2-[(1S,5R)-3-benzyl-1,5-dimethyl-3-bicyclo[3.2.0]heptanyl]acetyl chloride (PubChem CID 59077274) has the molecular formula C18H23ClO and a molecular weight of 290.83 g/mol. Its IUPAC name is 2-[(1S,5R)-3-benzyl-1,5-dimethyl-3-bicyclo[3.2.0]heptanyl]acetyl chloride.
| Compound Name | 2-[(1S,5R)-3-benzyl-1,5-dimethyl-3-bicyclo[3.2.0]heptanyl]acetyl chloride |
|---|---|
| PubChem CID | 59077274 |
| Molecular Formula | C18H23ClO |
| Molecular Weight | 290.83 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 2-[(1S,5R)-3-benzyl-1,5-dimethyl-3-bicyclo[3.2.0]heptanyl]acetyl chloride |
| SMILES | C[C@@]12CC[C@]1(C)CC(CC(=O)Cl)(Cc1ccccc1)C2 |
| InChI | InChI=1S/C18H23ClO/c1-16-8-9-17(16,2)13-18(12-16,11-15(19)20)10-14-6-4-3-5-7-14/h3-7H,8-13H2,1-2H3/t16-,17+,18? |
| InChIKey | KVMLUAXQCXJGPG-JWTNVVGKSA-N |
| XLogP | 4.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.83 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|