About ethyl (2Z)-2-(2-fluoroethoxyimino)-2-(2-methyl-1,3-thiazol-4-yl)acetate
ethyl (2Z)-2-(2-fluoroethoxyimino)-2-(2-methyl-1,3-thiazol-4-yl)acetate (PubChem CID 59077442) has the molecular formula C10H13FN2O3S
and a molecular weight of 260.29 g/mol. Its IUPAC name is ethyl (2Z)-2-(2-fluoroethoxyimino)-2-(2-methyl-1,3-thiazol-4-yl)acetate.
Molecular Properties
| Compound Name | ethyl (2Z)-2-(2-fluoroethoxyimino)-2-(2-methyl-1,3-thiazol-4-yl)acetate |
| PubChem CID | 59077442 |
| Molecular Formula | C10H13FN2O3S |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | ethyl (2Z)-2-(2-fluoroethoxyimino)-2-(2-methyl-1,3-thiazol-4-yl)acetate |
| SMILES | CCOC(=O)/C(=N\OCCF)c1csc(C)n1 |
| InChI | InChI=1S/C10H13FN2O3S/c1-3-15-10(14)9(13-16-5-4-11)8-6-17-7(2)12-8/h6H,3-5H2,1-2H3/b13-9- |
| InChIKey | AXYHGDUBBIIKOM-LCYFTJDESA-N |
| XLogP | 1.70 |
| TPSA | 60.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2Z)-2-(2-fluoroethoxyimino)-2-(2-methyl-1,3-thiazol-4-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2Z)-2-(2-fluoroethoxyimino)-2-(2-methyl-1,3-thiazol-4-yl)acetate?
The IUPAC name of ethyl (2Z)-2-(2-fluoroethoxyimino)-2-(2-methyl-1,3-thiazol-4-yl)acetate (CID 59077442) is ethyl (2Z)-2-(2-fluoroethoxyimino)-2-(2-methyl-1,3-thiazol-4-yl)acetate.
What is the SMILES notation for ethyl (2Z)-2-(2-fluoroethoxyimino)-2-(2-methyl-1,3-thiazol-4-yl)acetate?
The canonical SMILES for ethyl (2Z)-2-(2-fluoroethoxyimino)-2-(2-methyl-1,3-thiazol-4-yl)acetate is CCOC(=O)/C(=N\OCCF)c1csc(C)n1.
What is the InChIKey of ethyl (2Z)-2-(2-fluoroethoxyimino)-2-(2-methyl-1,3-thiazol-4-yl)acetate?
The InChIKey is AXYHGDUBBIIKOM-LCYFTJDESA-N. The full InChI is InChI=1S/C10H13FN2O3S/c1-3-15-10(14)9(13-16-5-4-11)8-6-17-7(2)12-8/h6H,3-5H2,1-2H3/b13-9-.
What are the key properties of ethyl (2Z)-2-(2-fluoroethoxyimino)-2-(2-methyl-1,3-thiazol-4-yl)acetate?
ethyl (2Z)-2-(2-fluoroethoxyimino)-2-(2-methyl-1,3-thiazol-4-yl)acetate has a molecular weight of 260.29 g/mol, XLogP of 1.70, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2Z)-2-(2-fluoroethoxyimino)-2-(2-methyl-1,3-thiazol-4-yl)acetate is sourced from PubChem (CID 59077442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).