About 5-[(1R)-1-(2-chlorophenyl)ethyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine
5-[(1R)-1-(2-chlorophenyl)ethyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine (PubChem CID 59078186) has the molecular formula C15H16ClNS
and a molecular weight of 277.82 g/mol. Its IUPAC name is 5-[(1R)-1-(2-chlorophenyl)ethyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine.
Molecular Properties
| Compound Name | 5-[(1R)-1-(2-chlorophenyl)ethyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine |
| PubChem CID | 59078186 |
| Molecular Formula | C15H16ClNS |
| Molecular Weight | 277.82 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 5-[(1R)-1-(2-chlorophenyl)ethyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine |
| SMILES | C[C@H](c1ccccc1Cl)N1CCc2sccc2C1 |
| InChI | InChI=1S/C15H16ClNS/c1-11(13-4-2-3-5-14(13)16)17-8-6-15-12(10-17)7-9-18-15/h2-5,7,9,11H,6,8,10H2,1H3/t11-/m1/s1 |
| InChIKey | LRTCZMUUAXFPKV-LLVKDONJSA-N |
| XLogP | 4.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.82 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(1R)-1-(2-chlorophenyl)ethyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1R)-1-(2-chlorophenyl)ethyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine?
The IUPAC name of 5-[(1R)-1-(2-chlorophenyl)ethyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine (CID 59078186) is 5-[(1R)-1-(2-chlorophenyl)ethyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine.
What is the SMILES notation for 5-[(1R)-1-(2-chlorophenyl)ethyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine?
The canonical SMILES for 5-[(1R)-1-(2-chlorophenyl)ethyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine is C[C@H](c1ccccc1Cl)N1CCc2sccc2C1.
What is the InChIKey of 5-[(1R)-1-(2-chlorophenyl)ethyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine?
The InChIKey is LRTCZMUUAXFPKV-LLVKDONJSA-N. The full InChI is InChI=1S/C15H16ClNS/c1-11(13-4-2-3-5-14(13)16)17-8-6-15-12(10-17)7-9-18-15/h2-5,7,9,11H,6,8,10H2,1H3/t11-/m1/s1.
What are the key properties of 5-[(1R)-1-(2-chlorophenyl)ethyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine?
5-[(1R)-1-(2-chlorophenyl)ethyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine has a molecular weight of 277.82 g/mol, XLogP of 4.52, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1R)-1-(2-chlorophenyl)ethyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine is sourced from PubChem (CID 59078186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).