C10H19Ac2N3O3 — CID 59078205
actinium;(2S,3R,4S,5R,6S)-5-azido-6-tert-butyl-2-methyloxane-3,4-diol (PubChem CID 59078205) has the molecular formula C10H19Ac2N3O3 and a molecular weight of 683.28 g/mol. Its IUPAC name is actinium;(2S,3R,4S,5R,6S)-5-azido-6-tert-butyl-2-methyloxane-3,4-diol.
| Compound Name | actinium;(2S,3R,4S,5R,6S)-5-azido-6-tert-butyl-2-methyloxane-3,4-diol |
|---|---|
| PubChem CID | 59078205 |
| Molecular Formula | C10H19Ac2N3O3 |
| Molecular Weight | 683.28 g/mol |
| Exact Mass | 683.20 |
| IUPAC Name | actinium;(2S,3R,4S,5R,6S)-5-azido-6-tert-butyl-2-methyloxane-3,4-diol |
| SMILES | C[C@@H]1O[C@@H](C(C)(C)C)[C@H](N=[N+]=[N-])[C@H](O)[C@H]1O.[Ac].[Ac] |
| InChI | InChI=1S/C10H19N3O3.2Ac/c1-5-7(14)8(15)6(12-13-11)9(16-5)10(2,3)4;;/h5-9,14-15H,1-4H3;;/t5-,6+,7-,8-,9+;;/m0../s1 |
| InChIKey | GREJMLUABIJONI-CMCZTEHISA-N |
| XLogP | 1.22 |
| TPSA | 98.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|