C32H52O7 — CID 59078360
(3R,5R,6R,7S,9R,11E,14R)-14-ethyl-3,5,7,9,11,13-hexamethyl-7-prop-2-enoxy-6-[(3R,4S,6R)-3,4,6-trimethyloxan-2-yl]oxy-1-oxacyclotetradec-11-ene-2,4,10-trione (PubChem CID 59078360) has the molecular formula C32H52O7 and a molecular weight of 548.76 g/mol. Its IUPAC name is (3R,5R,6R,7S,9R,11E,14R)-14-ethyl-3,5,7,9,11,13-hexamethyl-7-prop-2-enoxy-6-[(3R,4S,6R)-3,4,6-trimethyloxan-2-yl]oxy-1-oxacyclotetradec-11-ene-2,4,10-trione.
| Compound Name | (3R,5R,6R,7S,9R,11E,14R)-14-ethyl-3,5,7,9,11,13-hexamethyl-7-prop-2-enoxy-6-[(3R,4S,6R)-3,4,6-trimethyloxan-2-yl]oxy-1-oxacyclotetradec-11-ene-2,4,10-trione |
|---|---|
| PubChem CID | 59078360 |
| Molecular Formula | C32H52O7 |
| Molecular Weight | 548.76 g/mol |
| Exact Mass | 548.37 |
| IUPAC Name | (3R,5R,6R,7S,9R,11E,14R)-14-ethyl-3,5,7,9,11,13-hexamethyl-7-prop-2-enoxy-6-[(3R,4S,6R)-3,4,6-trimethyloxan-2-yl]oxy-1-oxacyclotetradec-11-ene-2,4,10-trione |
| SMILES | C=CCO[C@@]1(C)C[C@@H](C)C(=O)/C(C)=C/C(C)[C@@H](CC)OC(=O)[C@H](C)C(=O)[C@H](C)[C@H]1OC1O[C@H](C)C[C@H](C)[C@H]1C |
| InChI | InChI=1S/C32H52O7/c1-12-14-36-32(11)17-21(6)27(33)20(5)15-19(4)26(13-2)38-30(35)25(10)28(34)24(9)29(32)39-31-23(8)18(3)16-22(7)37-31/h12,15,18-19,21-26,29,31H,1,13-14,16-17H2,2-11H3/b20-15+/t18-,19?,21+,22+,23+,24-,25+,26+,29+,31?,32-/m0/s1 |
| InChIKey | YRHRBUQFOLJCOR-NZHDIFRRSA-N |
| XLogP | 6.09 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.76 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|