C19H26O — CID 59078697
1-[(1S,4aS,10aR)-1,4a,6-trimethyl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]ethanone (PubChem CID 59078697) has the molecular formula C19H26O and a molecular weight of 270.42 g/mol. Its IUPAC name is 1-[(1S,4aS,10aR)-1,4a,6-trimethyl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]ethanone.
| Compound Name | 1-[(1S,4aS,10aR)-1,4a,6-trimethyl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]ethanone |
|---|---|
| PubChem CID | 59078697 |
| Molecular Formula | C19H26O |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | 1-[(1S,4aS,10aR)-1,4a,6-trimethyl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]ethanone |
| SMILES | CC(=O)[C@@]1(C)CCC[C@]2(C)c3cc(C)ccc3CC[C@@H]12 |
| InChI | InChI=1S/C19H26O/c1-13-6-7-15-8-9-17-18(3,14(2)20)10-5-11-19(17,4)16(15)12-13/h6-7,12,17H,5,8-11H2,1-4H3/t17-,18+,19+/m0/s1 |
| InChIKey | HJOLNUMIGUBYQG-IPMKNSEASA-N |
| XLogP | 4.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |